CAS 13551-73-0

5-Chloro-1,3-dimethyl-4-nitropyrazole

Description:

5-Chloro-1,3-dimethyl-4-nitropyrazole is an organic compound belonging to the pyrazole class, characterized by its unique structural features that include a chloro group, two methyl groups, and a nitro group attached to the pyrazole ring. This compound typically exhibits a yellow to orange crystalline appearance and is known for its stability under normal conditions. It is often utilized in various applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its potential reactivity, particularly in nitration and reduction reactions. Additionally, the chlorine atom can influence the compound's solubility and reactivity, making it a valuable building block in organic synthesis. Safety considerations are important when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate safety measures should be taken. Overall, 5-Chloro-1,3-dimethyl-4-nitropyrazole is a significant compound in the field of organic chemistry with diverse applications.

Formula: C₅H₆ClN₃O₂

InChI: InChI=1/C5H6ClN3O2/c1-3-4(9(10)11)5(6)8(2)7-3/h1-2H3

SMILES: Cc1c(c(Cl)n(C)n1)N(=O)=O

Synonyms:

• 5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole

5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole

CAS: 13551-73-0

Formula: C₅H₆ClN₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.5730

Ref: IN-DA003MLM

5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole

CAS: 13551-73-0

5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole

Purity: 97%

Color and Shape: White Powder

Molecular weight: 175.57g/mol

Ref: 54-OR23810

5-Chloro-4-nitro-1,3-dimethylpyrazole

CAS: 13551-73-0

Formula: C₅H₆ClN₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 175.57

Ref: 10-F017437

5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole

CAS: 13551-73-0

5-Chloro-1,3-dimethyl-4-nitro-1H-pyrazole is a polyphosphoric acid that has been shown to be an effective inhibitor of nitric oxide (NO) in the body. The compound is synthesized by the reaction of 1,3-dimethyl-4-nitrosobenzene with polyphosphoric acid and acetic anhydride. 5-Chloro-1,3-dimethyl-4-nitropyrazole inhibits the synthesis of NO by reacting with the enzyme nitric oxide synthase (NOS). This inhibition leads to a decrease in inflammatory responses. 5CDMNP also has intramolecular oxidative cyclization activity, which allows it to form a stable covalent bond with DNA and RNA molecules. The nitro group on this molecule is capable of undergoing intramolecular oxidative cyclization reactions. This process forms a five membered ring from two molecules

Formula: C₅H₆ClN₃O₂

Purity: Min. 95%

Molecular weight: 175.57 g/mol

Ref: 3D-NAA55173