
CAS 1355172-19-8
:α-Ethyl-6-(4-ethyl-1-piperazinyl)-5-methyl-3-pyridinemethanamine
Description:
α-Ethyl-6-(4-ethyl-1-piperazinyl)-5-methyl-3-pyridinemethanamine, identified by its CAS number 1355172-19-8, is a chemical compound that belongs to the class of pyridine derivatives. This substance features a pyridine ring substituted with an ethyl group and a piperazine moiety, which contributes to its potential pharmacological properties. The presence of the piperazine ring often indicates activity related to neurotransmitter modulation, making it of interest in medicinal chemistry, particularly in the development of psychoactive agents. The compound's structure suggests it may exhibit basic properties due to the amine functional group, which can participate in hydrogen bonding and ionic interactions. Additionally, its lipophilicity, influenced by the ethyl and methyl substituents, may affect its bioavailability and permeability across biological membranes. While specific biological activities and applications may vary, compounds of this nature are typically investigated for their potential therapeutic effects in various neurological and psychiatric conditions. Further research would be necessary to elucidate its specific properties and potential uses.
Formula:C15H26N4
InChI:InChI=1S/C15H26N4/c1-4-14(16)13-10-12(3)15(17-11-13)19-8-6-18(5-2)7-9-19/h10-11,14H,4-9,16H2,1-3H3
InChI key:InChIKey=ZODSKVUQJDKGOC-UHFFFAOYSA-N
SMILES:CC1=C(N=CC(C(CC)N)=C1)N2CCN(CC)CC2
Synonyms:- α-Ethyl-6-(4-ethyl-1-piperazinyl)-5-methyl-3-pyridinemethanamine
- 3-Pyridinemethanamine, α-ethyl-6-(4-ethyl-1-piperazinyl)-5-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.