CAS 1355172-52-9

4-[(2-Fluorophenoxy)methyl]-1H-1,2,3-triazole-1-acetic acid

Description:

4-[(2-Fluorophenoxy)methyl]-1H-1,2,3-triazole-1-acetic acid is a chemical compound characterized by its unique triazole ring structure, which contributes to its potential biological activity. The presence of a fluorophenoxy group enhances its lipophilicity and may influence its interaction with biological targets. This compound typically exhibits properties such as moderate solubility in organic solvents and varying solubility in water, depending on pH. The triazole moiety is known for its role in medicinal chemistry, often exhibiting antifungal and antibacterial properties. Additionally, the acetic acid functional group can impart acidic characteristics, influencing the compound's reactivity and potential applications in pharmaceuticals. Its specific structural features suggest potential use in drug development, particularly in targeting specific enzymes or receptors. Overall, this compound's unique combination of functional groups and structural characteristics makes it a subject of interest in various fields, including medicinal chemistry and material science.

Formula: C₁₁H₁₀FN₃O₃

InChI: InChI=1S/C11H10FN3O3/c12-9-3-1-2-4-10(9)18-7-8-5-15(14-13-8)6-11(16)17/h1-5H,6-7H2,(H,16,17)

InChI key: InChIKey=CQWFLINWBSBHSW-UHFFFAOYSA-N

SMILES: C(OC1=C(F)C=CC=C1)C2=CN(CC(O)=O)N=N2

Synonyms:

• 4-[(2-Fluorophenoxy)methyl]-1H-1,2,3-triazole-1-acetic acid
• 1H-1,2,3-Triazole-1-acetic acid, 4-[(2-fluorophenoxy)methyl]-