
CAS 1355172-53-0
:6-(Dipropylamino)-2-methyl-3-pyridinecarboxylic acid
Description:
6-(Dipropylamino)-2-methyl-3-pyridinecarboxylic acid, identified by its CAS number 1355172-53-0, is a chemical compound that features a pyridine ring substituted with a carboxylic acid group and a dipropylamino group. This compound is characterized by its relatively complex structure, which includes a pyridine moiety, a methyl group, and a dipropylamino substituent. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions, potentially acting as a weak acid. The dipropylamino group contributes to its basicity and may influence its solubility and reactivity in various solvents. Additionally, the compound's molecular structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both basic and acidic functional groups that can interact with biological targets. Overall, this compound's unique combination of functional groups makes it an interesting subject for further research in organic and medicinal chemistry.
Formula:C13H20N2O2
InChI:InChI=1S/C13H20N2O2/c1-4-8-15(9-5-2)12-7-6-11(13(16)17)10(3)14-12/h6-7H,4-5,8-9H2,1-3H3,(H,16,17)
InChI key:InChIKey=JGRLUNFPFNPHGZ-UHFFFAOYSA-N
SMILES:N(CCC)(CCC)C=1N=C(C)C(C(O)=O)=CC1
Synonyms:- 6-(Dipropylamino)-2-methyl-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 6-(dipropylamino)-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.