
CAS 1355174-58-1
:4-[5-[(1,1-Dimethylethyl)thio]-6-methyl-2-pyridinyl]morpholine
Description:
4-[5-[(1,1-Dimethylethyl)thio]-6-methyl-2-pyridinyl]morpholine, identified by its CAS number 1355174-58-1, is a chemical compound characterized by its complex structure that includes a morpholine ring and a pyridine moiety. The presence of a thioether group, specifically a tert-butylthio group, contributes to its unique chemical properties and potential reactivity. This compound is typically categorized as an organic heterocyclic compound due to the inclusion of nitrogen in its ring structures. It may exhibit various biological activities, making it of interest in pharmaceutical research and development. The molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, its solubility and stability in different solvents can vary, influencing its behavior in chemical reactions and formulations. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and related fields.
Formula:C14H22N2OS
InChI:InChI=1S/C14H22N2OS/c1-11-12(18-14(2,3)4)5-6-13(15-11)16-7-9-17-10-8-16/h5-6H,7-10H2,1-4H3
InChI key:InChIKey=CSVVLVGAMFDMSC-UHFFFAOYSA-N
SMILES:CC1=NC(=CC=C1SC(C)(C)C)N2CCOCC2
Synonyms:- Morpholine, 4-[5-[(1,1-dimethylethyl)thio]-6-methyl-2-pyridinyl]-
- 4-[5-[(1,1-Dimethylethyl)thio]-6-methyl-2-pyridinyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.