CymitQuimica logo

CAS 1355175-63-1

:

2-Methyl-6-(1-piperidinyl)-3-pyridinecarboxaldehyde

Description:
2-Methyl-6-(1-piperidinyl)-3-pyridinecarboxaldehyde is a chemical compound characterized by its pyridine and piperidine functional groups. It features a pyridine ring substituted with a methyl group and an aldehyde group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the piperidine moiety enhances its biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential interactions with biological targets, which could lead to pharmacological effects. The compound's reactivity is influenced by the aldehyde functional group, allowing for various chemical transformations, including condensation reactions. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, 2-Methyl-6-(1-piperidinyl)-3-pyridinecarboxaldehyde represents a versatile building block in the synthesis of more complex organic molecules.
Formula:C12H16N2O
InChI:InChI=1S/C12H16N2O/c1-10-11(9-15)5-6-12(13-10)14-7-3-2-4-8-14/h5-6,9H,2-4,7-8H2,1H3
InChI key:InChIKey=SPNGPJJFFVSAME-UHFFFAOYSA-N
SMILES:CC1=NC(=CC=C1C=O)N2CCCCC2
Synonyms:
  • 2-Methyl-6-(1-piperidinyl)-3-pyridinecarboxaldehyde
  • 3-Pyridinecarboxaldehyde, 2-methyl-6-(1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.