CAS 1355177-68-2

[2-(3-Furanyl)-1-piperidinyl]phenylmethanone

Description:

[2-(3-Furanyl)-1-piperidinyl]phenylmethanone, identified by its CAS number 1355177-68-2, is a chemical compound that features a complex structure incorporating a furan ring, a piperidine moiety, and a phenylmethanone group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the furan ring contributes to its aromatic characteristics and may influence its reactivity and interaction with biological targets. The piperidine ring adds to the compound's basicity and can participate in hydrogen bonding, which is crucial for its interaction with receptors or enzymes. Additionally, the phenylmethanone structure may enhance lipophilicity, affecting the compound's solubility and permeability. Overall, this compound's unique structural features suggest potential applications in drug development, particularly in areas targeting neurological or psychiatric conditions, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₆H₁₇NO₂

InChI: InChI=1S/C16H17NO2/c18-16(13-6-2-1-3-7-13)17-10-5-4-8-15(17)14-9-11-19-12-14/h1-3,6-7,9,11-12,15H,4-5,8,10H2

InChI key: InChIKey=RRSMHEXCMOQOLT-UHFFFAOYSA-N

SMILES: C(=O)(N1C(CCCC1)C=2C=COC2)C3=CC=CC=C3

Synonyms:

• [2-(3-Furanyl)-1-piperidinyl]phenylmethanone
• Methanone, [2-(3-furanyl)-1-piperidinyl]phenyl-