
CAS 1355179-38-2
:4-[5-(1-Aminopropyl)-2-pyridinyl]-1-piperazinecarboxaldehyde
Description:
4-[5-(1-Aminopropyl)-2-pyridinyl]-1-piperazinecarboxaldehyde, identified by its CAS number 1355179-38-2, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyridine moiety. This compound features an aldehyde functional group, which is indicative of its potential reactivity in various chemical reactions, particularly in condensation reactions. The presence of the 1-aminopropyl group suggests that it may exhibit biological activity, possibly interacting with neurotransmitter systems or other biological pathways. The compound's molecular structure allows for hydrogen bonding and potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research or pharmaceutical development. Overall, this compound represents a unique scaffold that may be explored for its therapeutic potential or as a building block in organic synthesis.
Formula:C13H20N4O
InChI:InChI=1S/C13H20N4O/c1-2-12(14)11-3-4-13(15-9-11)17-7-5-16(10-18)6-8-17/h3-4,9-10,12H,2,5-8,14H2,1H3
InChI key:InChIKey=NXLDSDBNTCVLNB-UHFFFAOYSA-N
SMILES:C(CC)(N)C1=CC=C(N=C1)N2CCN(C=O)CC2
Synonyms:- 4-[5-(1-Aminopropyl)-2-pyridinyl]-1-piperazinecarboxaldehyde
- 1-Piperazinecarboxaldehyde, 4-[5-(1-aminopropyl)-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.