
CAS 1355182-06-7
:5-Ethenyl-6-methyl-N-(1-methylethyl)-2-pyridinamine
Description:
5-Ethenyl-6-methyl-N-(1-methylethyl)-2-pyridinamine, identified by its CAS number 1355182-06-7, is a chemical compound that belongs to the class of pyridinamines. This substance features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and is substituted with an ethenyl group and a methyl group at specific positions. The presence of the N-(1-methylethyl) substituent indicates that it has an isopropyl group attached to the nitrogen atom, contributing to its overall structure and potentially influencing its reactivity and solubility. The compound may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. Its unique structure suggests potential applications in pharmaceuticals or agrochemicals, although specific biological activities or uses would depend on further research. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its reactivity and potential toxicity.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-5-10-6-7-11(12-8(2)3)13-9(10)4/h5-8H,1H2,2-4H3,(H,12,13)
InChI key:InChIKey=XKAKKKGRUWNGOJ-UHFFFAOYSA-N
SMILES:C(=C)C1=C(C)N=C(NC(C)C)C=C1
Synonyms:- 2-Pyridinamine, 5-ethenyl-6-methyl-N-(1-methylethyl)-
- 5-Ethenyl-6-methyl-N-(1-methylethyl)-2-pyridinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.