CAS 1355192-60-7

Methyl 6-(4-formyl-1-piperazinyl)-4-methyl-3-pyridinecarboxylate

Description:

Methyl 6-(4-formyl-1-piperazinyl)-4-methyl-3-pyridinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyridine ring, a piperazine moiety, and a formyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the formyl group suggests that it may participate in various chemical reactions, such as nucleophilic additions or condensation reactions. The methyl ester functional group indicates that it can undergo hydrolysis to yield the corresponding carboxylic acid. Additionally, the piperazine ring may impart certain pharmacological properties, making this compound of interest in medicinal chemistry. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors for its application in research or pharmaceutical development. Overall, this compound's unique structural features position it as a candidate for further investigation in various chemical and biological contexts.

Formula: C₁₃H₁₇N₃O₃

InChI: InChI=1S/C13H17N3O3/c1-10-7-12(14-8-11(10)13(18)19-2)16-5-3-15(9-17)4-6-16/h7-9H,3-6H2,1-2H3

InChI key: InChIKey=GSGBKAJRCQTHPI-UHFFFAOYSA-N

SMILES: CC=1C=C(N=CC1C(OC)=O)N2CCN(C=O)CC2

Synonyms:

• Methyl 6-(4-formyl-1-piperazinyl)-4-methyl-3-pyridinecarboxylate
• 3-Pyridinecarboxylic acid, 6-(4-formyl-1-piperazinyl)-4-methyl-, methyl ester