
CAS 1355196-98-3
:1-(5-Ethenyl-4-methyl-2-pyridinyl)hexahydro-1H-azepine
Description:
1-(5-Ethenyl-4-methyl-2-pyridinyl)hexahydro-1H-azepine is a chemical compound characterized by its unique structure, which includes a hexahydro-1H-azepine ring fused with a pyridine moiety that features an ethenyl and methyl substituent. This compound is part of a class of nitrogen-containing heterocycles, which often exhibit interesting biological activities and can serve as potential pharmacophores in medicinal chemistry. The presence of the ethenyl group suggests potential for reactivity, particularly in addition reactions, while the pyridine ring may contribute to the compound's electronic properties and solubility. The hexahydro-1H-azepine structure provides a saturated framework that can influence the compound's stability and conformational flexibility. Overall, the combination of these features may result in diverse interactions with biological targets, making it a subject of interest in drug discovery and development. Further studies would be necessary to elucidate its specific properties, reactivity, and potential applications in various fields.
Formula:C14H20N2
InChI:InChI=1S/C14H20N2/c1-3-13-11-15-14(10-12(13)2)16-8-6-4-5-7-9-16/h3,10-11H,1,4-9H2,2H3
InChI key:InChIKey=HWHPERZQGFICFX-UHFFFAOYSA-N
SMILES:CC=1C=C(N=CC1C=C)N2CCCCCC2
Synonyms:- 1H-Azepine, 1-(5-ethenyl-4-methyl-2-pyridinyl)hexahydro-
- 1-(5-Ethenyl-4-methyl-2-pyridinyl)hexahydro-1H-azepine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.