CAS 13552-09-5
:2-Amino-1,3-octadecanediol
Description:
2-Amino-1,3-octadecanediol, with the CAS number 13552-09-5, is an organic compound characterized by its long hydrocarbon chain and the presence of both amino and hydroxyl functional groups. This substance is classified as a diol due to the presence of two alcohol (-OH) groups, which contribute to its hydrophilic properties. The amino group (-NH2) enhances its potential for forming hydrogen bonds, making it useful in various biochemical applications. Typically, 2-amino-1,3-octadecanediol is a waxy solid at room temperature, exhibiting low solubility in water but higher solubility in organic solvents. Its long alkyl chain imparts surfactant properties, which can be beneficial in formulations such as emulsifiers or stabilizers in cosmetic and pharmaceutical products. Additionally, this compound may play a role in biological systems, potentially acting as a precursor for the synthesis of more complex molecules. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C18H39NO2
InChI:InChI=1S/C18H39NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-18(21)17(19)16-20/h17-18,20-21H,2-16,19H2,1H3
InChI key:InChIKey=OTKJDMGTUTTYMP-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCC)C(C(CO)N)O
Synonyms:- 1,3-Dihydroxy-2-amino-octadecane
- 1,3-Octadecanediol, 2-amino-
- 2-Amino-1,3-octadecanediol
- 2-Aminooctadecane-1,3-diol
- <span class="text-smallcaps">DL</span>-Sphinganine
- DL-Sphinganine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
