CAS 13552-72-2
:Isocorydine hydrochloride
Description:
Isocorydine hydrochloride is a chemical compound that belongs to the class of alkaloids, specifically derived from the opium poppy and related plants. It is characterized by its molecular structure, which includes a bicyclic framework typical of many isoquinoline alkaloids. This compound is often studied for its potential pharmacological properties, including analgesic and anti-inflammatory effects. Isocorydine hydrochloride is typically encountered as a white to off-white crystalline powder, soluble in water and various organic solvents, which facilitates its use in research and potential therapeutic applications. The hydrochloride salt form enhances its stability and solubility, making it more suitable for formulation in pharmaceutical preparations. As with many alkaloids, it may exhibit a range of biological activities, and ongoing research continues to explore its mechanisms of action and potential uses in medicine. Safety and handling precautions are essential due to its bioactive nature, and it should be managed in accordance with relevant regulations and guidelines.
Formula:C20H23NO4·ClH
InChI:InChI=1S/C20H23NO4.ClH/c1-21-8-7-12-10-15(24-3)20(25-4)18-16(12)13(21)9-11-5-6-14(23-2)19(22)17(11)18;/h5-6,10,13,22H,7-9H2,1-4H3;1H/t13-;/m0./s1
InChI key:InChIKey=ZWSKLEMBDRWSNZ-ZOWNYOTGSA-N
SMILES:O(C)C1=C2C=3[C@](CC=4C2=C(O)C(OC)=CC4)(N(C)CCC3C=C1OC)[H].Cl
Synonyms:- 6aα-Aporphin-11-ol, 1,2,10-trimethoxy-, hydrochloride
- (+)-Isocorydine hydrochloride
- 4H-Dibenzo[de,g]quinolin-11-ol, 5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, hydrochloride, (S)-
- 4H-Dibenzo[de,g]quinolin-11-ol, 5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, hydrochloride, (6aS)-
- Isocorydine hydrochloride
- 4H-Dibenzo[de,g]quinolin-11-ol, 5,6,6a,7-tetrahydro-1,2,10-trimethoxy-6-methyl-, hydrochloride (1:1), (6aS)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
(+)-Isocorydine hydrochloride
CAS:(+)-Isocorydine hydrochloridePurity:≥98%Molecular weight:377.87g/mol(+)-Isocorydine hydrochloride
CAS:(+)-Isocorydine hydrochloride (Isocorydine HCl) is a eukaryote protein kinases Inhibitor.Formula:C20H24ClNO4Purity:98% - >99.99%Color and Shape:SolidMolecular weight:377.87Ref: TM-T4291
1mg107.00€2mg161.00€5mg269.00€10mg389.00€25mg718.00€50mg1,159.00€100mg1,600.00€500mgTo inquire1mL*10mM (DMSO)288.00€(+)-isocorydine hydrochloride
CAS:Natural alkaloidFormula:C20H23NO4HClPurity:≥ 98.0 % (HPLC)Color and Shape:PowderMolecular weight:377.87(+)-Isocorydine HCl
CAS:(+)-Isocorydine HCl is an isoquinoline alkaloid derivative, which is naturally sourced from plants in the Papaveraceae family. As an alkaloid, it is notable for its structural complexity and pharmacological properties. The mode of action of (+)-Isocorydine HCl primarily involves interaction with cellular pathways that can influence apoptosis, cellular proliferation, and potentially modulate various signaling cascades. This interaction suggests its potential utility in exploring therapeutic effects, particularly related to anti-cancer research.
Formula:C20H23NO4Purity:Min. 95%Color and Shape:PowderMolecular weight:341.4 g/molIsocorydine Hydrochloride
CAS:Controlled ProductFormula:C20H23NO4·ClHColor and Shape:NeatMolecular weight:377.86





