CymitQuimica logo

CAS 1355201-53-4

:

α-Ethyl-6-(1-piperidinyl)-3-pyridinemethanamine

Description:
α-Ethyl-6-(1-piperidinyl)-3-pyridinemethanamine, identified by its CAS number 1355201-53-4, is a chemical compound that belongs to the class of substituted pyridines. This substance features a pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom, and is further substituted with an ethyl group and a piperidinyl moiety. The presence of the piperidine ring contributes to its potential biological activity, as piperidine derivatives are often associated with various pharmacological effects. The compound may exhibit properties such as being a ligand for certain receptors or enzymes, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest it may have applications in the fields of neuroscience or pharmacology, particularly in the development of therapeutics targeting neurological disorders. However, specific data regarding its solubility, stability, and reactivity would require further investigation through experimental studies or literature review.
Formula:C13H21N3
InChI:InChI=1S/C13H21N3/c1-2-12(14)11-6-7-13(15-10-11)16-8-4-3-5-9-16/h6-7,10,12H,2-5,8-9,14H2,1H3
InChI key:InChIKey=MGFJYVJXWZPMDV-UHFFFAOYSA-N
SMILES:C(CC)(N)C1=CC=C(N=C1)N2CCCCC2
Synonyms:
  • α-Ethyl-6-(1-piperidinyl)-3-pyridinemethanamine
  • 3-Pyridinemethanamine, α-ethyl-6-(1-piperidinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.