CymitQuimica logo

CAS 1355202-96-8

:

5-Methyl-6-(1-piperazinyl)-3-pyridinemethanol

Description:
5-Methyl-6-(1-piperazinyl)-3-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is substituted with a methyl group and a piperazine moiety. This compound typically exhibits properties associated with both the pyridine and piperazine functional groups, including potential basicity due to the nitrogen atoms present. The presence of the hydroxymethyl group contributes to its polarity and solubility in polar solvents. It may also exhibit biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's structure suggests it could interact with various biological targets, potentially influencing neurotransmitter systems or other pathways. Its specific applications and efficacy would depend on further studies, including pharmacokinetics and pharmacodynamics. As with many organic compounds, safety and handling considerations are essential, particularly regarding its stability and reactivity under different conditions. Overall, 5-Methyl-6-(1-piperazinyl)-3-pyridinemethanol represents a versatile structure with potential implications in drug design and development.
Formula:C11H17N3O
InChI:InChI=1S/C11H17N3O/c1-9-6-10(8-15)7-13-11(9)14-4-2-12-3-5-14/h6-7,12,15H,2-5,8H2,1H3
InChI key:InChIKey=DPCNLAURVCVLOG-UHFFFAOYSA-N
SMILES:CC1=C(N=CC(CO)=C1)N2CCNCC2
Synonyms:
  • 3-Pyridinemethanol, 5-methyl-6-(1-piperazinyl)-
  • 5-Methyl-6-(1-piperazinyl)-3-pyridinemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.