
CAS 1355219-79-2
:6-(4-Acetyl-1-piperazinyl)-5-methyl-3-pyridinecarbonitrile
Description:
6-(4-Acetyl-1-piperazinyl)-5-methyl-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring, a piperazine moiety, and an acetyl group. The presence of the nitrile functional group contributes to its potential reactivity and solubility properties. This compound typically exhibits moderate polarity due to the combination of hydrophobic and hydrophilic regions within its structure. It may possess biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The acetyl group can influence the compound's lipophilicity and metabolic stability, while the piperazine ring is often associated with various pharmacological properties. Additionally, the compound's molecular weight and specific functional groups can affect its interactions with biological targets, making it a candidate for further research in drug discovery and development. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature.
Formula:C13H16N4O
InChI:InChI=1S/C13H16N4O/c1-10-7-12(8-14)9-15-13(10)17-5-3-16(4-6-17)11(2)18/h7,9H,3-6H2,1-2H3
InChI key:InChIKey=QCDOYLJYPIIPSD-UHFFFAOYSA-N
SMILES:CC1=C(N2CCN(C(C)=O)CC2)N=CC(C#N)=C1
Synonyms:- 3-Pyridinecarbonitrile, 6-(4-acetyl-1-piperazinyl)-5-methyl-
- 6-(4-Acetyl-1-piperazinyl)-5-methyl-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.