CymitQuimica logo

CAS 1355224-00-8

:

6-(Diethylamino)-2-methyl-3-pyridinecarboxylic acid

Description:
6-(Diethylamino)-2-methyl-3-pyridinecarboxylic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a diethylamino group, which enhances its basicity and solubility in organic solvents. The presence of a carboxylic acid functional group contributes to its acidity and potential reactivity, making it useful in various chemical reactions and applications. The methyl group at the 2-position of the pyridine ring influences the compound's steric and electronic properties, potentially affecting its biological activity. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry. Its specific interactions and applications would depend on its structural characteristics, including its ability to form hydrogen bonds and engage in electrostatic interactions. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-4-13(5-2)10-7-6-9(11(14)15)8(3)12-10/h6-7H,4-5H2,1-3H3,(H,14,15)
InChI key:InChIKey=PPVFGPVGRUXTKY-UHFFFAOYSA-N
SMILES:N(CC)(CC)C=1N=C(C)C(C(O)=O)=CC1
Synonyms:
  • 6-(Diethylamino)-2-methyl-3-pyridinecarboxylic acid
  • 3-Pyridinecarboxylic acid, 6-(diethylamino)-2-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.