
CAS 1355225-84-1
:4-[5-(1-Hydroxyethyl)-3-methyl-2-pyridinyl]-1-piperazinecarboxaldehyde
Description:
4-[5-(1-Hydroxyethyl)-3-methyl-2-pyridinyl]-1-piperazinecarboxaldehyde, identified by its CAS number 1355225-84-1, is a chemical compound characterized by its complex structure, which includes a piperazine ring and a pyridine moiety. This compound features a carboxaldehyde functional group, which is indicative of its potential reactivity, particularly in condensation reactions. The presence of the hydroxyethyl group enhances its solubility in polar solvents and may influence its biological activity. The methyl group on the pyridine ring can affect the electronic properties and steric hindrance of the molecule, potentially impacting its interactions with biological targets. This compound may be of interest in medicinal chemistry due to its structural features, which could confer specific pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Overall, this compound represents a unique structure that may have applications in drug development or as a biochemical probe.
Formula:C13H19N3O2
InChI:InChI=1S/C13H19N3O2/c1-10-7-12(11(2)18)8-14-13(10)16-5-3-15(9-17)4-6-16/h7-9,11,18H,3-6H2,1-2H3
InChI key:InChIKey=SPGLHCAVIQLGED-UHFFFAOYSA-N
SMILES:CC1=C(N=CC(C(C)O)=C1)N2CCN(C=O)CC2
Synonyms:- 4-[5-(1-Hydroxyethyl)-3-methyl-2-pyridinyl]-1-piperazinecarboxaldehyde
- 1-Piperazinecarboxaldehyde, 4-[5-(1-hydroxyethyl)-3-methyl-2-pyridinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.