CAS 1355227-28-9

[6-[(1,1-Dimethylethyl)thio]-2-methyl-3-pyridinyl]phenylmethanone

Description:

The chemical substance known as [6-[(1,1-Dimethylethyl)thio]-2-methyl-3-pyridinyl]phenylmethanone, with the CAS number 1355227-28-9, is a synthetic organic compound that belongs to the class of pyridine derivatives. It features a complex structure characterized by the presence of a pyridine ring, a phenyl group, and a thioether functional group, which contributes to its unique chemical properties. The presence of the bulky tert-butylthio group enhances its lipophilicity, potentially influencing its solubility and biological activity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its specific reactivity and interactions can be influenced by the functional groups present, allowing for potential applications in agrochemicals or pharmaceuticals. As with many organic compounds, its stability, reactivity, and potential toxicity would need to be evaluated in the context of its intended use. Proper handling and safety measures should be observed due to the potential hazards associated with chemical substances.

Formula: C₁₇H₁₉NOS

InChI: InChI=1S/C17H19NOS/c1-12-14(16(19)13-8-6-5-7-9-13)10-11-15(18-12)20-17(2,3)4/h5-11H,1-4H3

InChI key: InChIKey=CCYBDYZISQTOCW-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(C)N=C(SC(C)(C)C)C=C1)C2=CC=CC=C2

Synonyms:

• Methanone, [6-[(1,1-dimethylethyl)thio]-2-methyl-3-pyridinyl]phenyl-
• [6-[(1,1-Dimethylethyl)thio]-2-methyl-3-pyridinyl]phenylmethanone