CymitQuimica logo

CAS 1355229-06-9

:

1-[5-[(1,1-Dimethylethyl)thio]-6-methyl-2-pyridinyl]-1,2,3,4-tetrahydroquinoline

Description:
1-[5-[(1,1-Dimethylethyl)thio]-6-methyl-2-pyridinyl]-1,2,3,4-tetrahydroquinoline is a chemical compound characterized by its complex structure, which includes a tetrahydroquinoline core fused with a pyridine ring. This compound features a thioether functional group, specifically a tert-butylthio group, which contributes to its chemical reactivity and potential biological activity. The presence of the methyl group on the pyridine ring may influence its electronic properties and steric hindrance. This compound is likely to exhibit lipophilic characteristics due to the presence of the bulky tert-butyl group, which can affect its solubility and permeability in biological systems. Additionally, the tetrahydroquinoline structure is often associated with various pharmacological activities, making it of interest in medicinal chemistry. Its CAS number, 1355229-06-9, allows for precise identification and retrieval of information regarding its properties, synthesis, and potential applications in research and industry.
Formula:C19H24N2S
InChI:InChI=1S/C19H24N2S/c1-14-17(22-19(2,3)4)11-12-18(20-14)21-13-7-9-15-8-5-6-10-16(15)21/h5-6,8,10-12H,7,9,13H2,1-4H3
InChI key:InChIKey=DERQUTFOHKAASK-UHFFFAOYSA-N
SMILES:CC1=NC(N2C=3C(CCC2)=CC=CC3)=CC=C1SC(C)(C)C
Synonyms:
  • 1-[5-[(1,1-Dimethylethyl)thio]-6-methyl-2-pyridinyl]-1,2,3,4-tetrahydroquinoline
  • Quinoline, 1-[5-[(1,1-dimethylethyl)thio]-6-methyl-2-pyridinyl]-1,2,3,4-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.