
CAS 1355234-16-0
:6-(3,4-Dihydro-1(2H)-quinolinyl)-4-methyl-3-pyridinecarboxaldehyde
Description:
6-(3,4-Dihydro-1(2H)-quinolinyl)-4-methyl-3-pyridinecarboxaldehyde is a chemical compound characterized by its complex structure, which includes a pyridine ring and a quinoline moiety. This compound features a carboxaldehyde functional group, which is indicative of its potential reactivity, particularly in condensation reactions. The presence of the methyl group on the pyridine ring contributes to its overall hydrophobic character, while the quinoline structure may impart biological activity, making it of interest in medicinal chemistry. The compound's molecular framework suggests it may exhibit various interactions with biological targets, potentially influencing its pharmacological properties. Additionally, the presence of multiple heteroatoms in the rings can enhance solubility in polar solvents. As with many organic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound's unique structural features make it a candidate for further research in drug development and synthetic chemistry.
Formula:C16H16N2O
InChI:InChI=1S/C16H16N2O/c1-12-9-16(17-10-14(12)11-19)18-8-4-6-13-5-2-3-7-15(13)18/h2-3,5,7,9-11H,4,6,8H2,1H3
InChI key:InChIKey=JJXBQEWJXKPUHV-UHFFFAOYSA-N
SMILES:CC=1C=C(N2C=3C(CCC2)=CC=CC3)N=CC1C=O
Synonyms:- 6-(3,4-Dihydro-1(2H)-quinolinyl)-4-methyl-3-pyridinecarboxaldehyde
- 3-Pyridinecarboxaldehyde, 6-(3,4-dihydro-1(2H)-quinolinyl)-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.