CAS 1355238-59-3

1-(5-Ethenyl-2-pyridinyl)-4-(1-methylethyl)piperazine

Description:

1-(5-Ethenyl-2-pyridinyl)-4-(1-methylethyl)piperazine, identified by its CAS number 1355238-59-3, is a chemical compound that features a piperazine core substituted with both a pyridine and an isopropyl group. This compound exhibits characteristics typical of piperazine derivatives, including potential biological activity due to the presence of the nitrogen atoms in the piperazine ring, which can participate in hydrogen bonding and interact with various biological targets. The ethenyl group contributes to its reactivity and may influence its pharmacological properties. The presence of the pyridine ring can enhance lipophilicity and affect the compound's solubility in organic solvents. Such structural features suggest that this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific properties such as melting point, boiling point, and solubility would require empirical measurement or detailed literature references for precise values. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and biological applications.

Formula: C₁₄H₂₁N₃

InChI: InChI=1S/C14H21N3/c1-4-13-5-6-14(15-11-13)17-9-7-16(8-10-17)12(2)3/h4-6,11-12H,1,7-10H2,2-3H3

InChI key: InChIKey=KUAKHXFKFGBWQU-UHFFFAOYSA-N

SMILES: C(C)(C)N1CCN(CC1)C2=CC=C(C=C)C=N2

Synonyms:

• 1-(5-Ethenyl-2-pyridinyl)-4-(1-methylethyl)piperazine
• Piperazine, 1-(5-ethenyl-2-pyridinyl)-4-(1-methylethyl)-