CAS 1355241-54-1

2-Chloro-5-iodothiazolo[5,4-b]pyridine

Description:

2-Chloro-5-iodothiazolo[5,4-b]pyridine is a heterocyclic compound characterized by its unique structural features, which include a thiazole ring fused to a pyridine ring. This compound contains both chlorine and iodine substituents, which can significantly influence its reactivity and biological activity. The presence of the thiazole moiety often imparts interesting pharmacological properties, making such compounds of interest in medicinal chemistry. The chlorine atom typically enhances lipophilicity, while the iodine can facilitate certain types of chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the compound may exhibit specific electronic properties due to the arrangement of its heteroatoms, which can affect its interaction with biological targets. Its CAS number, 1355241-54-1, allows for precise identification in chemical databases, facilitating research and development in various fields, including pharmaceuticals and agrochemicals. Overall, 2-Chloro-5-iodothiazolo[5,4-b]pyridine represents a valuable scaffold for the synthesis of novel compounds with potential applications in drug discovery.

Formula: C₆H₂ClIN₂S

InChI: InChI=1S/C6H2ClIN2S/c7-6-9-3-1-2-4(8)10-5(3)11-6/h1-2H

InChI key: InChIKey=DQZBBGQUGHGRRH-UHFFFAOYSA-N

SMILES: ClC1=NC=2C(S1)=NC(I)=CC2

Synonyms:

• 2-Chloro-5-iodothiazolo[5,4-b]pyridine
• Thiazolo[5,4-b]pyridine, 2-chloro-5-iodo-
• 2-Chloro-5-iodo-[1,3]thiazolo[5,4-b]pyridine