CAS 1355246-83-1

Methyl 5′-fluoro-2′-methoxy[1,1′-biphenyl]-4-carboxylate

Description:

Methyl 5′-fluoro-2′-methoxy[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) and a fluoro substituent (-F) on the biphenyl framework contributes to its chemical reactivity and potential applications in pharmaceuticals or agrochemicals. The carboxylate functional group (-COOCH3) indicates that it is an ester, which can influence its solubility and reactivity in various chemical reactions. This compound may exhibit specific biological activities due to its structural features, making it of interest in medicinal chemistry. Its molecular properties, such as melting point, boiling point, and solubility, would depend on the overall molecular interactions and substituent effects. As with many organic compounds, safety data and handling precautions are essential for laboratory work involving this substance.

Formula: C₁₅H₁₃FO₃

InChI: InChI=1S/C15H13FO3/c1-18-14-8-7-12(16)9-13(14)10-3-5-11(6-4-10)15(17)19-2/h3-9H,1-2H3

InChI key: InChIKey=CPEBTCDECJGSMF-UHFFFAOYSA-N

SMILES: O(C)C1=C(C=C(F)C=C1)C2=CC=C(C(OC)=O)C=C2

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 5′-fluoro-2′-methoxy-, methyl ester
• Methyl 5′-fluoro-2′-methoxy[1,1′-biphenyl]-4-carboxylate

Methyl 4-(5-fluoro-2-methoxyphenyl)benzoate

CAS: 1355246-83-1

Formula: C₁₅H₁₃FO₃

Molecular weight: 260.2603

Ref: IN-DA009WMB