CymitQuimica logo

CAS 1355246-87-5

:

[1,1′-Biphenyl]-4-carboxylic acid, 2′-amino-, ethyl ester, hydrochloride (1:1)

Description:
[1,1′-Biphenyl]-4-carboxylic acid, 2′-amino-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group and an amino group indicates that this compound has both acidic and basic properties, making it potentially useful in various chemical reactions and applications. The ethyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which enhances its utility in biological and pharmaceutical contexts. The compound may exhibit biological activity due to the presence of the amino group, which can participate in hydrogen bonding and other interactions. Overall, this compound's unique structural features and functional groups make it a candidate for further investigation in medicinal chemistry and related fields.
Formula:C15H15NO2·ClH
InChI:InChI=1S/C15H15NO2.ClH/c1-2-18-15(17)12-9-7-11(8-10-12)13-5-3-4-6-14(13)16;/h3-10H,2,16H2,1H3;1H
InChI key:InChIKey=XYRCKRPMVQLITA-UHFFFAOYSA-N
SMILES:NC1=C(C2=CC=C(C(OCC)=O)C=C2)C=CC=C1.Cl
Synonyms:
  • [1,1′-Biphenyl]-4-carboxylic acid, 2′-amino-, ethyl ester, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.