CAS 1355246-93-3

[1,1′-Biphenyl]-4-carboxylic acid, 4′-amino-3-fluoro-, ethyl ester, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-4-carboxylic acid, 4′-amino-3-fluoro-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group and an ethyl ester indicates that it has both acidic and ester functionalities, which can influence its solubility and reactivity. The amino group attached to the biphenyl structure suggests potential for hydrogen bonding and reactivity in various chemical reactions. The fluorine atom introduces electronegativity, which can affect the compound's electronic properties and reactivity. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, making it useful in biological and pharmaceutical applications. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in different environments.

Formula: C₁₅H₁₄FNO₂·ClH

InChI: InChI=1S/C15H14FNO2.ClH/c1-2-19-15(18)13-8-5-11(9-14(13)16)10-3-6-12(17)7-4-10;/h3-9H,2,17H2,1H3;1H

InChI key: InChIKey=YMCFBJTUJILDPW-UHFFFAOYSA-N

SMILES: FC=1C=C(C=CC1C(OCC)=O)C2=CC=C(N)C=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 4′-amino-3-fluoro-, ethyl ester, hydrochloride (1:1)