CAS 1355246-96-6
:1-(2-Bromo-4-fluorophenyl)pyrrolidine
Description:
1-(2-Bromo-4-fluorophenyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a substituted phenyl group. The presence of a bromine atom and a fluorine atom on the phenyl ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of halogen substituents that can influence biological interactions. Additionally, the pyrrolidine moiety may impart certain pharmacological properties, making it a subject of interest in drug discovery. Safety and handling precautions are essential when working with this compound, as halogenated compounds can pose health risks. Overall, 1-(2-Bromo-4-fluorophenyl)pyrrolidine represents a versatile structure in organic synthesis and medicinal chemistry research.
Formula:C10H11BrFN
InChI:InChI=1S/C10H11BrFN/c11-9-7-8(12)3-4-10(9)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2
InChI key:InChIKey=WCKMJETXNAKABG-UHFFFAOYSA-N
SMILES:BrC1=C(N2CCCC2)C=CC(F)=C1
Synonyms:- 1-(2-Bromo-4-fluorophenyl)pyrrolidine
- Pyrrolidine, 1-(2-bromo-4-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
