CAS 1355247-00-5
:4-Bromo-2-(dimethoxymethyl)-1-(phenylmethoxy)benzene
Description:
4-Bromo-2-(dimethoxymethyl)-1-(phenylmethoxy)benzene is an organic compound characterized by its complex structure, which includes a bromine atom, methoxy groups, and a phenylmethoxy moiety. This compound features a benzene ring substituted with a bromine atom at the 4-position and a dimethoxymethyl group at the 2-position, along with a phenylmethoxy group at the 1-position. The presence of the bromine atom introduces electrophilic characteristics, making it a potential candidate for further chemical reactions, such as nucleophilic substitutions. The dimethoxymethyl group enhances the compound's solubility in organic solvents and may influence its reactivity and stability. Additionally, the phenylmethoxy group can provide steric hindrance and electronic effects that may affect the compound's overall reactivity. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in drug development or as a building block in organic synthesis. However, specific properties such as melting point, boiling point, and solubility would require experimental determination or literature reference for precise values.
Formula:C16H17BrO3
InChI:InChI=1S/C16H17BrO3/c1-18-16(19-2)14-10-13(17)8-9-15(14)20-11-12-6-4-3-5-7-12/h3-10,16H,11H2,1-2H3
InChI key:InChIKey=VXVGVYXZKHSEDA-UHFFFAOYSA-N
SMILES:C(OC)(OC)C1=C(OCC2=CC=CC=C2)C=CC(Br)=C1
Synonyms:- Benzene, 4-bromo-2-(dimethoxymethyl)-1-(phenylmethoxy)-
- 4-Bromo-2-(dimethoxymethyl)-1-(phenylmethoxy)benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
