CAS 1355247-01-6
:3-Bromo-N-butyl-2-fluorobenzenemethanamine
Description:
3-Bromo-N-butyl-2-fluorobenzenemethanamine is an organic compound characterized by its complex structure, which includes a bromine atom and a fluorine atom attached to a benzene ring. The presence of the butyl group contributes to its hydrophobic characteristics, while the amine functional group indicates potential basicity and reactivity in various chemical reactions. This compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic and hydrophilic regions. The bromine and fluorine substituents can influence its reactivity, making it a potential candidate for various synthetic applications, including medicinal chemistry and material science. Additionally, the compound may exhibit biological activity, which could be of interest in pharmacological research. Safety and handling precautions should be observed, as halogenated compounds can pose health risks and environmental concerns. Overall, 3-Bromo-N-butyl-2-fluorobenzenemethanamine represents a unique structure with potential applications in various fields of chemistry.
Formula:C11H15BrFN
InChI:InChI=1S/C11H15BrFN/c1-2-3-7-14-8-9-5-4-6-10(12)11(9)13/h4-6,14H,2-3,7-8H2,1H3
InChI key:InChIKey=YLMDQNXJXCJJES-UHFFFAOYSA-N
SMILES:C(NCCCC)C1=C(F)C(Br)=CC=C1
Synonyms:- 3-Bromo-N-butyl-2-fluorobenzenemethanamine
- Benzenemethanamine, 3-bromo-N-butyl-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.