
CAS 1355247-02-7
:1-[(3-Bromo-2-fluorophenyl)methyl]-4-methylpiperazine
Description:
1-[(3-Bromo-2-fluorophenyl)methyl]-4-methylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 3-bromo-2-fluorophenyl group attached to a methyl group, contributing to its unique properties. The presence of bromine and fluorine substituents on the aromatic ring can influence the compound's reactivity, polarity, and biological activity. The piperazine moiety is known for its role in various pharmacological applications, often serving as a scaffold in drug design due to its ability to interact with biological targets. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound's characteristics, such as solubility, stability, and interaction with other molecules, can be influenced by the specific arrangement of its substituents. Overall, 1-[(3-Bromo-2-fluorophenyl)methyl]-4-methylpiperazine represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C12H16BrFN2
InChI:InChI=1S/C12H16BrFN2/c1-15-5-7-16(8-6-15)9-10-3-2-4-11(13)12(10)14/h2-4H,5-9H2,1H3
InChI key:InChIKey=LFHPPILNGNYQFY-UHFFFAOYSA-N
SMILES:C(C1=C(F)C(Br)=CC=C1)N2CCN(C)CC2
Synonyms:- 1-[(3-Bromo-2-fluorophenyl)methyl]-4-methylpiperazine
- Piperazine, 1-[(3-bromo-2-fluorophenyl)methyl]-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.