CAS 1355247-04-9
:1-Chloro-2-(cyclopentyloxy)-4-nitrobenzene
Description:
1-Chloro-2-(cyclopentyloxy)-4-nitrobenzene is an organic compound characterized by its aromatic structure, which includes a nitro group and a chloro substituent on a benzene ring. The presence of the cyclopentyloxy group introduces a cyclic ether functionality, contributing to its unique chemical properties. This compound is likely to exhibit moderate polarity due to the electronegative chlorine and nitro groups, which can influence its solubility in various solvents. The nitro group is known for its electron-withdrawing properties, which can affect the reactivity of the compound in electrophilic aromatic substitution reactions. Additionally, the cyclopentyl group may provide steric hindrance, influencing the compound's reactivity and interactions with other molecules. Due to these characteristics, 1-Chloro-2-(cyclopentyloxy)-4-nitrobenzene may find applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Safety and handling precautions should be observed, as compounds containing chlorine and nitro groups can pose health and environmental risks.
Formula:C11H12ClNO3
InChI:InChI=1S/C11H12ClNO3/c12-10-6-5-8(13(14)15)7-11(10)16-9-3-1-2-4-9/h5-7,9H,1-4H2
InChI key:InChIKey=OOAYNYFPUNQORC-UHFFFAOYSA-N
SMILES:O(C1=CC(N(=O)=O)=CC=C1Cl)C2CCCC2
Synonyms:- Benzene, 1-chloro-2-(cyclopentyloxy)-4-nitro-
- 1-Chloro-2-(cyclopentyloxy)-4-nitrobenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
