CAS 1355247-06-1

3′-Chloro-4′-cyano[1,1′-biphenyl]-3-carboxylic acid

Description:

3′-Chloro-4′-cyano[1,1′-biphenyl]-3-carboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a cyano group at the 4′ position introduces significant polarity and reactivity to the molecule. The carboxylic acid functional group at the 3 position contributes to its acidic properties and enhances its solubility in polar solvents. This compound may exhibit interesting chemical behavior due to the electron-withdrawing effects of the cyano and chloro substituents, which can influence its reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Additionally, the structural features suggest potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for practical applications.

Formula: C₁₄H₈ClNO₂

InChI: InChI=1S/C14H8ClNO2/c15-13-7-10(4-5-12(13)8-16)9-2-1-3-11(6-9)14(17)18/h1-7H,(H,17,18)

InChI key: InChIKey=MUZFISYMSYFCBF-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C#N)C2=CC(C(O)=O)=CC=C2

Synonyms:

• [1,1′-Biphenyl]-3-carboxylic acid, 3′-chloro-4′-cyano-
• 3′-Chloro-4′-cyano[1,1′-biphenyl]-3-carboxylic acid