CAS 1355247-08-3

2-Bromo-6-fluoro-N-(2-methylpropyl)benzenemethanamine

Description:

2-Bromo-6-fluoro-N-(2-methylpropyl)benzenemethanamine is an organic compound characterized by its complex structure, which includes a benzene ring substituted with a bromine atom at the 2-position and a fluorine atom at the 6-position. The compound features an amine functional group, specifically a benzenemethanamine, which is further substituted with a 2-methylpropyl group, enhancing its hydrophobic characteristics. This substitution pattern contributes to its potential biological activity and interaction with various receptors or enzymes. The presence of halogens (bromine and fluorine) often influences the compound's reactivity, stability, and lipophilicity, making it of interest in medicinal chemistry and drug design. Additionally, the compound's molecular structure suggests it may exhibit unique physical properties, such as solubility in organic solvents and potential for forming hydrogen bonds due to the amine group. Overall, 2-Bromo-6-fluoro-N-(2-methylpropyl)benzenemethanamine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₁H₁₅BrFN

InChI: InChI=1S/C11H15BrFN/c1-8(2)6-14-7-9-10(12)4-3-5-11(9)13/h3-5,8,14H,6-7H2,1-2H3

InChI key: InChIKey=RZDDUPAGARNBIK-UHFFFAOYSA-N

SMILES: C(NCC(C)C)C1=C(Br)C=CC=C1F

Synonyms:

• 2-Bromo-6-fluoro-N-(2-methylpropyl)benzenemethanamine
• Benzenemethanamine, 2-bromo-6-fluoro-N-(2-methylpropyl)-