CAS 1355247-13-0

3-Fluoro-3′-(phenylmethoxy)-1,1′-biphenyl

Description:

3-Fluoro-3′-(phenylmethoxy)-1,1′-biphenyl is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the 3-position of one of the biphenyl rings introduces unique electronic properties, potentially enhancing its reactivity and influencing its interactions with other molecules. The phenylmethoxy group, which is an ether functional group, contributes to the compound's solubility and polarity. This compound may exhibit interesting properties such as fluorescence or specific binding affinities due to its structural features. It is likely to be of interest in fields such as materials science, organic synthesis, or medicinal chemistry, where modifications to biphenyl derivatives can lead to novel applications. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its physical and chemical properties, as well as its potential applications in various scientific domains.

Formula: C₁₉H₁₅FO

InChI: InChI=1S/C19H15FO/c20-18-10-4-8-16(12-18)17-9-5-11-19(13-17)21-14-15-6-2-1-3-7-15/h1-13H,14H2

InChI key: InChIKey=OCNHUSPSZIDALV-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C=2C=C(C=CC2)C3=CC(F)=CC=C3

Synonyms:

• 3-Fluoro-3′-(phenylmethoxy)-1,1′-biphenyl
• 1,1′-Biphenyl, 3-fluoro-3′-(phenylmethoxy)-
• 1-(Benzyloxy)-3-(3-fluorophenyl)benzene