CAS 1355247-20-9

1,1-Dimethylethyl 3-[(2-nitrophenoxy)methyl]-1-azetidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(2-nitrophenoxy)methyl]-1-azetidinecarboxylate, identified by its CAS number 1355247-20-9, is a chemical compound characterized by its azetidine ring structure, which is a four-membered cyclic amine. This compound features a carboxylate functional group, contributing to its potential reactivity and solubility properties. The presence of a nitrophenoxy group indicates that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. The dimethyl substituents on the azetidine ring suggest steric hindrance, which may influence its reactivity and interactions with other molecules. Additionally, the compound's structure implies potential applications in medicinal chemistry or as an intermediate in organic synthesis. Its specific physical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally, as they are not universally defined and can vary based on purity and environmental conditions.

Formula: C₁₅H₂₀N₂O₅

InChI: InChI=1S/C15H20N2O5/c1-15(2,3)22-14(18)16-8-11(9-16)10-21-13-7-5-4-6-12(13)17(19)20/h4-7,11H,8-10H2,1-3H3

InChI key: InChIKey=NTNADDPVWUPXPA-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CC(COC2=C(N(=O)=O)C=CC=C2)C1

Synonyms:

• 1,1-Dimethylethyl 3-[(2-nitrophenoxy)methyl]-1-azetidinecarboxylate
• 1-Azetidinecarboxylic acid, 3-[(2-nitrophenoxy)methyl]-, 1,1-dimethylethyl ester