CAS 1355247-27-6
:2′,3′-Difluoro[1,1′-biphenyl]-4-acetic acid
Description:
2′,3′-Difluoro[1,1′-biphenyl]-4-acetic acid is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two fluorine atoms at the 2' and 3' positions of one of the phenyl rings contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. The acetic acid functional group at the 4-position introduces acidity and polar characteristics, making the compound soluble in polar solvents. This compound may exhibit interesting biological activity due to its structural features, which can influence interactions with biological targets. Its molecular structure allows for potential applications in pharmaceuticals, agrochemicals, or materials science. The CAS number 1355247-27-6 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, 2′,3′-Difluoro[1,1′-biphenyl]-4-acetic acid is a fluorinated organic compound with potential significance in various chemical and biological contexts.
Formula:C14H10F2O2
InChI:InChI=1S/C14H10F2O2/c15-12-3-1-2-11(14(12)16)10-6-4-9(5-7-10)8-13(17)18/h1-7H,8H2,(H,17,18)
InChI key:InChIKey=VTXARBLUYYUGIA-UHFFFAOYSA-N
SMILES:FC1=C(C=CC=C1F)C2=CC=C(CC(O)=O)C=C2
Synonyms:- 2′,3′-Difluoro[1,1′-biphenyl]-4-acetic acid
- [1,1′-Biphenyl]-4-acetic acid, 2′,3′-difluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
