CAS 1355247-33-4

[1,1′-Biphenyl]-4-carboxylic acid, 4′-amino-, ethyl ester, hydrochloride (1:1)

Description:

[1,1′-Biphenyl]-4-carboxylic acid, 4′-amino-, ethyl ester, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group and an amino group indicates that it has both acidic and basic properties, making it a zwitterionic compound in certain conditions. The ethyl ester functionality suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit biological activity due to the presence of the amino group, which can participate in hydrogen bonding and other interactions. Its molecular structure allows for potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₅H₁₅NO₂·ClH

InChI: InChI=1S/C15H15NO2.ClH/c1-2-18-15(17)13-5-3-11(4-6-13)12-7-9-14(16)10-8-12;/h3-10H,2,16H2,1H3;1H

InChI key: InChIKey=TVEQCKMBIAUZSV-UHFFFAOYSA-N

SMILES: C(OCC)(=O)C1=CC=C(C=C1)C2=CC=C(N)C=C2.Cl

Synonyms:

• [1,1′-Biphenyl]-4-carboxylic acid, 4′-amino-, ethyl ester, hydrochloride (1:1)