CAS 1355247-36-7
:4-Fluoro[1,1′-biphenyl]-2,2′-dicarboxylic acid
Description:
4-Fluoro[1,1′-biphenyl]-2,2′-dicarboxylic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluorine atom at the para position of one of the phenyl rings and two carboxylic acid groups at the 2 and 2' positions significantly influences its chemical properties. This compound is likely to exhibit moderate solubility in polar solvents due to the carboxylic acid groups, which can engage in hydrogen bonding. The fluorine substituent can enhance the compound's lipophilicity and may also affect its reactivity and interaction with biological systems. Additionally, the dicarboxylic acid functionality suggests potential for forming esters or amides, making it versatile for various synthetic applications. Its unique structure may also impart specific optical or electronic properties, making it of interest in materials science and organic electronics. As with many fluorinated compounds, it may exhibit increased stability and resistance to degradation, which can be advantageous in certain applications.
Formula:C14H9FO4
InChI:InChI=1S/C14H9FO4/c15-8-5-6-10(12(7-8)14(18)19)9-3-1-2-4-11(9)13(16)17/h1-7H,(H,16,17)(H,18,19)
InChI key:InChIKey=DNUOREFJMRMMKI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C=CC(F)=C1)C2=C(C(O)=O)C=CC=C2
Synonyms:- [1,1′-Biphenyl]-2,2′-dicarboxylic acid, 4-fluoro-
- 4-Fluoro[1,1′-biphenyl]-2,2′-dicarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.