CAS 1355247-45-8
:2′,3-Dichloro-5′-methyl[1,1′-biphenyl]-4-carbonitrile
Description:
2′,3-Dichloro-5′-methyl[1,1′-biphenyl]-4-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of two chlorine atoms at the 2′ and 3′ positions and a methyl group at the 5′ position on one of the phenyl rings contributes to its unique chemical properties. The carbonitrile functional group (-C≡N) at the 4-position of the biphenyl moiety enhances its reactivity and polarity, making it useful in various chemical applications. This compound is typically synthesized through specific halogenation and nitrile formation reactions. It may exhibit biological activity, which can be of interest in pharmaceutical research, particularly in the development of agrochemicals or other specialty chemicals. Additionally, its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the compound. As with many halogenated compounds, it is important to handle it with care due to potential environmental and health impacts.
Formula:C14H9Cl2N
InChI:InChI=1S/C14H9Cl2N/c1-9-2-5-13(15)12(6-9)10-3-4-11(8-17)14(16)7-10/h2-7H,1H3
InChI key:InChIKey=UTTJFFKVJIFHDH-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(Cl)=C(C#N)C=C2)C=C(C)C=C1
Synonyms:- 2′,3-Dichloro-5′-methyl[1,1′-biphenyl]-4-carbonitrile
- [1,1′-Biphenyl]-4-carbonitrile, 2′,3-dichloro-5′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
