CAS 1355247-48-1
:[1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-5-fluoro-, methyl ester, hydrochloride (1:1)
Description:
[1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-5-fluoro-, methyl ester, hydrochloride (1:1) is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a carboxylic acid group and an amino group indicates that it has both acidic and basic properties, making it potentially useful in various chemical reactions and applications. The methyl ester functionality suggests that it can undergo hydrolysis to release the corresponding carboxylic acid. The addition of a fluorine atom at the 5-position of the phenyl ring can influence the compound's reactivity and biological activity, potentially enhancing its lipophilicity or altering its interaction with biological targets. As a hydrochloride salt, it is likely to be more soluble in water, which can facilitate its use in pharmaceutical formulations. Overall, this compound may exhibit interesting properties for research in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C14H12FNO2·ClH
InChI:InChI=1S/C14H12FNO2.ClH/c1-18-14(17)11-5-10(6-12(15)7-11)9-3-2-4-13(16)8-9;/h2-8H,16H2,1H3;1H
InChI key:InChIKey=JIBDUUFPHJJEBT-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=C(C=C(F)C1)C2=CC(N)=CC=C2.Cl
Synonyms:- [1,1′-Biphenyl]-3-carboxylic acid, 3′-amino-5-fluoro-, methyl ester, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
