CAS 1355247-58-3
:2-Bromo-N-butyl-6-fluorobenzenemethanamine
Description:
2-Bromo-N-butyl-6-fluorobenzenemethanamine is a chemical compound characterized by its specific functional groups and structural features. It contains a bromine atom and a fluorine atom, which contribute to its reactivity and potential applications in various chemical reactions. The presence of the butyl group indicates that it has a hydrophobic character, which can influence its solubility and interaction with biological systems. The benzene ring provides aromatic stability, while the amine group suggests potential for hydrogen bonding and reactivity in nucleophilic substitution reactions. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural attributes that could affect biological activity. Additionally, the specific arrangement of substituents on the benzene ring can lead to varied electronic properties, impacting its behavior in chemical reactions. Overall, 2-Bromo-N-butyl-6-fluorobenzenemethanamine is a complex molecule with potential applications in various fields, including organic synthesis and drug development.
Formula:C11H15BrFN
InChI:InChI=1S/C11H15BrFN/c1-2-3-7-14-8-9-10(12)5-4-6-11(9)13/h4-6,14H,2-3,7-8H2,1H3
InChI key:InChIKey=BXNXFHVCVHRBIT-UHFFFAOYSA-N
SMILES:C(NCCCC)C1=C(Br)C=CC=C1F
Synonyms:- 2-Bromo-N-butyl-6-fluorobenzenemethanamine
- Benzenemethanamine, 2-bromo-N-butyl-6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
