CAS 1355247-62-9

Methyl 1-cyclopropyl-1H-benzimidazole-6-carboxylate

Description:

Methyl 1-cyclopropyl-1H-benzimidazole-6-carboxylate is a chemical compound characterized by its unique structural features, which include a benzimidazole core fused with a cyclopropyl group and a carboxylate ester functional group. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, such as stability and potential reactivity due to the presence of the carboxylate moiety. The benzimidazole structure often imparts biological activity, making such compounds of interest in medicinal chemistry and drug development. The methyl ester group enhances solubility and can influence the compound's pharmacokinetic properties. Additionally, the cyclopropyl ring can introduce strain, which may affect the compound's reactivity and interaction with biological targets. Overall, Methyl 1-cyclopropyl-1H-benzimidazole-6-carboxylate is a compound of interest for its potential applications in pharmaceuticals, particularly in the development of new therapeutic agents.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1S/C12H12N2O2/c1-16-12(15)8-2-5-10-11(6-8)14(7-13-10)9-3-4-9/h2,5-7,9H,3-4H2,1H3

InChI key: InChIKey=RUFICRIMUYXKHJ-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=C2N(C=NC2=CC1)C3CC3

Synonyms:

• Methyl 1-cyclopropyl-1H-benzimidazole-6-carboxylate
• 1H-Benzimidazole-6-carboxylic acid, 1-cyclopropyl-, methyl ester