CAS 1355247-63-0
:3-Chloro-3′-fluoro-4′-methyl[1,1′-biphenyl]-4-carbonitrile
Description:
3-Chloro-3′-fluoro-4′-methyl[1,1′-biphenyl]-4-carbonitrile is a chemical compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group, a fluoro group, and a methyl group on the biphenyl framework contributes to its unique chemical properties and reactivity. The carbonitrile functional group (-C≡N) indicates that the compound has a nitrile functional group, which can influence its polarity and solubility in various solvents. This compound may exhibit interesting biological activities and could be of interest in pharmaceutical research or material science. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the presence of substituents. Additionally, the compound's CAS number, 1355247-63-0, allows for easy identification and retrieval of information in chemical databases. Overall, the structural features of this compound suggest potential applications in various fields, including organic synthesis and medicinal chemistry.
Formula:C14H9ClFN
InChI:InChI=1S/C14H9ClFN/c1-9-2-3-11(7-14(9)16)10-4-5-12(8-17)13(15)6-10/h2-7H,1H3
InChI key:InChIKey=IXGMTTMNUXFKLU-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1C#N)C2=CC(F)=C(C)C=C2
Synonyms:- 3-Chloro-3′-fluoro-4′-methyl[1,1′-biphenyl]-4-carbonitrile
- [1,1′-Biphenyl]-4-carbonitrile, 3-chloro-3′-fluoro-4′-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.