CAS 1355247-69-6

4-Piperidinamine, 1-(3-methylbutyl)-, hydrochloride (1:2)

Description:

4-Piperidinamine, 1-(3-methylbutyl)-, hydrochloride (1:2) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. This substance features a 3-methylbutyl substituent, contributing to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit basic properties due to the presence of the amine group, allowing it to participate in protonation reactions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications in drug development.

Formula: C₁₀H₂₂N₂·2ClH

InChI: InChI=1S/C10H22N2.2ClH/c1-9(2)3-6-12-7-4-10(11)5-8-12;;/h9-10H,3-8,11H2,1-2H3;2*1H

InChI key: InChIKey=VWBWYTPOOOWJOG-UHFFFAOYSA-N

SMILES: C(CC(C)C)N1CCC(N)CC1.Cl

Synonyms:

• 4-Piperidinamine, 1-(3-methylbutyl)-, hydrochloride (1:2)

1-Isopentylpiperidin-4-amine hydrochloride

CAS: 1355247-69-6

1-Isopentylpiperidin-4-amine hydrochloride

Purity: 98%

Molecular weight: 206.76g/mol

Ref: 54-OR1059357