CymitQuimica logo

CAS 1355247-70-9

:

2-(1-Pyrrolidinyl)-3-(trifluoromethyl)pyridine

Description:
2-(1-Pyrrolidinyl)-3-(trifluoromethyl)pyridine, identified by its CAS number 1355247-70-9, is a chemical compound characterized by its pyridine ring substituted with a pyrrolidine group and a trifluoromethyl group. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The pyrrolidine moiety contributes to the compound's potential as a ligand in various chemical reactions and biological interactions. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of new drugs targeting specific biological pathways. Additionally, the trifluoromethyl group can impart unique electronic properties, which may affect the compound's reactivity and interaction with other molecules. As with many fluorinated compounds, it is essential to consider environmental and safety aspects during handling and disposal.
Formula:C10H11F3N2
InChI:InChI=1S/C10H11F3N2/c11-10(12,13)8-4-3-5-14-9(8)15-6-1-2-7-15/h3-5H,1-2,6-7H2
InChI key:InChIKey=BQICETOMRWQJSD-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(N=CC=C1)N2CCCC2
Synonyms:
  • 1-[3-(Trifluoromethyl)pyridin-2-yl]pyrrolidine
  • Pyridine, 2-(1-pyrrolidinyl)-3-(trifluoromethyl)-
  • 2-(1-Pyrrolidinyl)-3-(trifluoromethyl)pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.