CAS 1355247-76-5
:4-Bromo-5-ethoxy-N-methyl-2-nitrobenzenamine
Description:
4-Bromo-5-ethoxy-N-methyl-2-nitrobenzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, an ethoxy group, a methyl group, and a nitro group attached to a benzene ring. The presence of the bromine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The ethoxy group enhances its solubility in organic solvents, while the nitro group can influence its electronic properties, potentially making it a good candidate for applications in pharmaceuticals or agrochemicals. The N-methyl substitution indicates that the amine nitrogen is bonded to a methyl group, which can affect the compound's basicity and steric hindrance. Overall, this compound's unique combination of functional groups suggests it may exhibit interesting biological or chemical activity, warranting further investigation in synthetic and medicinal chemistry contexts. Safety and handling precautions should be observed due to the presence of potentially hazardous functional groups.
Formula:C9H11BrN2O3
InChI:InChI=1S/C9H11BrN2O3/c1-3-15-9-5-7(11-2)8(12(13)14)4-6(9)10/h4-5,11H,3H2,1-2H3
InChI key:InChIKey=IYHRUJIIFUWIHL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(NC)C=C(OCC)C(Br)=C1
Synonyms:- 4-Bromo-5-ethoxy-N-methyl-2-nitrobenzenamine
- Benzenamine, 4-bromo-5-ethoxy-N-methyl-2-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
