CymitQuimica logo

CAS 1355247-82-3

:

2-Chloro-4-methyl-3′-nitro-1,1′-biphenyl

Description:
2-Chloro-4-methyl-3′-nitro-1,1′-biphenyl, with the CAS number 1355247-82-3, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. This compound features a chlorine atom and a nitro group as substituents on the biphenyl framework, contributing to its chemical reactivity and potential applications. The presence of the chlorine atom typically enhances the compound's lipophilicity, while the nitro group can influence its electronic properties and reactivity, making it a candidate for various chemical reactions, including electrophilic aromatic substitution. Additionally, the methyl group provides steric hindrance, which can affect the compound's reactivity and interaction with other molecules. This compound may be of interest in fields such as materials science, pharmaceuticals, or agrochemicals, although specific applications would depend on further research into its properties and behavior in different environments. Safety and handling precautions should be observed due to the potential toxicity associated with nitro and halogenated compounds.
Formula:C13H10ClNO2
InChI:InChI=1S/C13H10ClNO2/c1-9-5-6-12(13(14)7-9)10-3-2-4-11(8-10)15(16)17/h2-8H,1H3
InChI key:InChIKey=AZKCSLHFFDCVBQ-UHFFFAOYSA-N
SMILES:ClC1=C(C2=CC(N(=O)=O)=CC=C2)C=CC(C)=C1
Synonyms:
  • 1,1′-Biphenyl, 2-chloro-4-methyl-3′-nitro-
  • 2-Chloro-4-methyl-3′-nitro-1,1′-biphenyl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.