CymitQuimica logo

CAS 1355247-84-5

:

3′-Fluoro-4′-methyl[1,1′-biphenyl]-3-acetic acid

Description:
3′-Fluoro-4′-methyl[1,1′-biphenyl]-3-acetic acid is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a fluoro group at the 3′ position and a methyl group at the 4′ position on one of the phenyl rings contributes to its unique chemical properties. This compound features an acetic acid functional group, which imparts acidic characteristics and can participate in various chemical reactions, such as esterification or amidation. The fluorine atom enhances the compound's lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's structural features suggest potential applications in pharmaceuticals or agrochemicals, where modifications to the biphenyl framework can lead to diverse biological activities. Its specific interactions and reactivity would depend on the surrounding environment and the presence of other functional groups. Overall, 3′-Fluoro-4′-methyl[1,1′-biphenyl]-3-acetic acid exemplifies the complexity and versatility of biphenyl derivatives in organic chemistry.
Formula:C15H13FO2
InChI:InChI=1S/C15H13FO2/c1-10-5-6-13(9-14(10)16)12-4-2-3-11(7-12)8-15(17)18/h2-7,9H,8H2,1H3,(H,17,18)
InChI key:InChIKey=VVLAWNDLVRTUDS-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1C)C2=CC(CC(O)=O)=CC=C2
Synonyms:
  • [1,1′-Biphenyl]-3-acetic acid, 3′-fluoro-4′-methyl-
  • 3′-Fluoro-4′-methyl[1,1′-biphenyl]-3-acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.