CAS 1355247-89-0

Methyl 3′-chloro-4′-cyano[1,1′-biphenyl]-4-carboxylate

Description:

Methyl 3′-chloro-4′-cyano[1,1′-biphenyl]-4-carboxylate is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a chloro group at the 3′ position and a cyano group at the 4′ position on one of the phenyl rings contributes to its reactivity and potential applications in organic synthesis. The carboxylate functional group, specifically the methyl ester, indicates that the compound can undergo hydrolysis to yield the corresponding carboxylic acid. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic nature, which may influence its solubility in organic solvents. Additionally, the presence of electron-withdrawing groups, such as the cyano and chloro substituents, can affect its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, this compound may have applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific reactivity and properties.

Formula: C₁₅H₁₀ClNO₂

InChI: InChI=1S/C15H10ClNO2/c1-19-15(18)11-4-2-10(3-5-11)12-6-7-13(9-17)14(16)8-12/h2-8H,1H3

InChI key: InChIKey=UZKKNFVNRRMTGV-UHFFFAOYSA-N

SMILES: ClC=1C=C(C=CC1C#N)C2=CC=C(C(OC)=O)C=C2

Synonyms:

• Methyl 3′-chloro-4′-cyano[1,1′-biphenyl]-4-carboxylate
• [1,1′-Biphenyl]-4-carboxylic acid, 3′-chloro-4′-cyano-, methyl ester

Methyl 4-(3-chloro-4-cyanophenyl)benzoate

CAS: 1355247-89-0

Formula: C₁₅H₁₀ClNO₂

Molecular weight: 271.6984

Ref: IN-DA009WKM