CAS 1355247-91-4
:3-Bromo-N-(1,1-dimethylethyl)-2-fluorobenzenemethanamine
Description:
3-Bromo-N-(1,1-dimethylethyl)-2-fluorobenzenemethanamine is an organic compound characterized by its complex structure, which includes a bromine atom and a fluorine atom attached to a benzene ring. The presence of the tert-butyl group (1,1-dimethylethyl) contributes to its steric bulk, influencing its reactivity and interactions with other molecules. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its solubility in various solvents. The bromine and fluorine substituents can also impart unique electronic properties, potentially enhancing its reactivity in nucleophilic substitution reactions. Additionally, the compound may have applications in medicinal chemistry or materials science, depending on its biological activity and stability. Its specific characteristics, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable chemical databases for precise applications.
Formula:C11H15BrFN
InChI:InChI=1S/C11H15BrFN/c1-11(2,3)14-7-8-5-4-6-9(12)10(8)13/h4-6,14H,7H2,1-3H3
InChI key:InChIKey=XCPUFZDMMVRRTR-UHFFFAOYSA-N
SMILES:C(NC(C)(C)C)C1=C(F)C(Br)=CC=C1
Synonyms:- Benzenemethanamine, 3-bromo-N-(1,1-dimethylethyl)-2-fluoro-
- 3-Bromo-N-(1,1-dimethylethyl)-2-fluorobenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
